C12H12Cl2FNO — CID 107574812
1-(3,5-dichloro-4-fluorophenyl)-3-methylpiperidin-4-one (PubChem CID 107574812) has the molecular formula C12H12Cl2FNO and a molecular weight of 276.14 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-fluorophenyl)-3-methylpiperidin-4-one.
| Compound Name | 1-(3,5-dichloro-4-fluorophenyl)-3-methylpiperidin-4-one |
|---|---|
| PubChem CID | 107574812 |
| Molecular Formula | C12H12Cl2FNO |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-(3,5-dichloro-4-fluorophenyl)-3-methylpiperidin-4-one |
| SMILES | CC1CN(c2cc(Cl)c(F)c(Cl)c2)CCC1=O |
| InChI | InChI=1S/C12H12Cl2FNO/c1-7-6-16(3-2-11(7)17)8-4-9(13)12(15)10(14)5-8/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | ZZBQEVPMRCOWLK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|