C15H16ClN — CID 107579824
3-(2-chloro-4,5-dimethylphenyl)-5-methylaniline (PubChem CID 107579824) has the molecular formula C15H16ClN and a molecular weight of 245.75 g/mol. Its IUPAC name is 3-(2-chloro-4,5-dimethylphenyl)-5-methylaniline.
| Compound Name | 3-(2-chloro-4,5-dimethylphenyl)-5-methylaniline |
|---|---|
| PubChem CID | 107579824 |
| Molecular Formula | C15H16ClN |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 3-(2-chloro-4,5-dimethylphenyl)-5-methylaniline |
| SMILES | Cc1cc(N)cc(-c2cc(C)c(C)cc2Cl)c1 |
| InChI | InChI=1S/C15H16ClN/c1-9-4-12(8-13(17)5-9)14-6-10(2)11(3)7-15(14)16/h4-8H,17H2,1-3H3 |
| InChIKey | YJGNPKIJMHRQDK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|