C14H13Cl2N — CID 107607819
2-chloro-4-(2-chloro-4,5-dimethylphenyl)aniline (PubChem CID 107607819) has the molecular formula C14H13Cl2N and a molecular weight of 266.17 g/mol. Its IUPAC name is 2-chloro-4-(2-chloro-4,5-dimethylphenyl)aniline.
| Compound Name | 2-chloro-4-(2-chloro-4,5-dimethylphenyl)aniline |
|---|---|
| PubChem CID | 107607819 |
| Molecular Formula | C14H13Cl2N |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-chloro-4-(2-chloro-4,5-dimethylphenyl)aniline |
| SMILES | Cc1cc(Cl)c(-c2ccc(N)c(Cl)c2)cc1C |
| InChI | InChI=1S/C14H13Cl2N/c1-8-5-11(12(15)6-9(8)2)10-3-4-14(17)13(16)7-10/h3-7H,17H2,1-2H3 |
| InChIKey | GKNHPEAGZGEJLG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|