C16H18ClN — CID 113319516
1-[3-(2-chloro-4,5-dimethylphenyl)phenyl]ethanamine (PubChem CID 113319516) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is 1-[3-(2-chloro-4,5-dimethylphenyl)phenyl]ethanamine.
| Compound Name | 1-[3-(2-chloro-4,5-dimethylphenyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 113319516 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-[3-(2-chloro-4,5-dimethylphenyl)phenyl]ethanamine |
| SMILES | Cc1cc(Cl)c(-c2cccc(C(C)N)c2)cc1C |
| InChI | InChI=1S/C16H18ClN/c1-10-7-15(16(17)8-11(10)2)14-6-4-5-13(9-14)12(3)18/h4-9,12H,18H2,1-3H3 |
| InChIKey | UHNJXNPHZKBTSY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |