C15H16ClNO — CID 107607763
2-chloro-4-(2-methoxy-3,4-dimethylphenyl)aniline (PubChem CID 107607763) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 2-chloro-4-(2-methoxy-3,4-dimethylphenyl)aniline.
| Compound Name | 2-chloro-4-(2-methoxy-3,4-dimethylphenyl)aniline |
|---|---|
| PubChem CID | 107607763 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-chloro-4-(2-methoxy-3,4-dimethylphenyl)aniline |
| SMILES | COc1c(-c2ccc(N)c(Cl)c2)ccc(C)c1C |
| InChI | InChI=1S/C15H16ClNO/c1-9-4-6-12(15(18-3)10(9)2)11-5-7-14(17)13(16)8-11/h4-8H,17H2,1-3H3 |
| InChIKey | XPHCXVQOLMIHMZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|