C14H17ClN2O2 — CID 174602053
4-(4-aminophenyl)-2,3-dimethoxyaniline;hydrochloride (PubChem CID 174602053) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3-dimethoxyaniline;hydrochloride.
| Compound Name | 4-(4-aminophenyl)-2,3-dimethoxyaniline;hydrochloride |
|---|---|
| PubChem CID | 174602053 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-(4-aminophenyl)-2,3-dimethoxyaniline;hydrochloride |
| SMILES | COc1c(N)ccc(-c2ccc(N)cc2)c1OC.Cl |
| InChI | InChI=1S/C14H16N2O2.ClH/c1-17-13-11(7-8-12(16)14(13)18-2)9-3-5-10(15)6-4-9;/h3-8H,15-16H2,1-2H3;1H |
| InChIKey | LTUATLQZKPBRAG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|