C20H28N2O2 — CID 19931595
4-(4-aminophenyl)-2,3-dibutoxyaniline (PubChem CID 19931595) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3-dibutoxyaniline.
| Compound Name | 4-(4-aminophenyl)-2,3-dibutoxyaniline |
|---|---|
| PubChem CID | 19931595 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 4-(4-aminophenyl)-2,3-dibutoxyaniline |
| SMILES | CCCCOc1c(N)ccc(-c2ccc(N)cc2)c1OCCCC |
| InChI | InChI=1S/C20H28N2O2/c1-3-5-13-23-19-17(15-7-9-16(21)10-8-15)11-12-18(22)20(19)24-14-6-4-2/h7-12H,3-6,13-14,21-22H2,1-2H3 |
| InChIKey | PQHQLDUCEFBAIY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|