About N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline
N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline (PubChem CID 107582845) has the molecular formula C17H27BrN2
and a molecular weight of 339.32 g/mol. Its IUPAC name is N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline.
Molecular Properties
| Compound Name | N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline |
| PubChem CID | 107582845 |
| Molecular Formula | C17H27BrN2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline |
| SMILES | Cc1cc(Br)cc(NC2(CN)CC(C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C17H27BrN2/c1-12-5-14(18)7-15(6-12)20-17(11-19)9-13(2)8-16(3,4)10-17/h5-7,13,20H,8-11,19H2,1-4H3 |
| InChIKey | GODNPEVUWPSPNZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline?
The IUPAC name of N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline (CID 107582845) is N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline.
What is the SMILES notation for N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline?
The canonical SMILES for N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline is Cc1cc(Br)cc(NC2(CN)CC(C)CC(C)(C)C2)c1.
What is the InChIKey of N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline?
The InChIKey is GODNPEVUWPSPNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27BrN2/c1-12-5-14(18)7-15(6-12)20-17(11-19)9-13(2)8-16(3,4)10-17/h5-7,13,20H,8-11,19H2,1-4H3.
What are the key properties of N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline?
N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline has a molecular weight of 339.32 g/mol, XLogP of 4.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(aminomethyl)-3,3,5-trimethylcyclohexyl]-3-bromo-5-methylaniline is sourced from PubChem (CID 107582845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).