C13H19BrN2O2S — CID 107582888
4-(aminomethyl)-N-(3-bromo-5-methylphenyl)-1,1-dioxothian-4-amine (PubChem CID 107582888) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(3-bromo-5-methylphenyl)-1,1-dioxothian-4-amine.
| Compound Name | 4-(aminomethyl)-N-(3-bromo-5-methylphenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 107582888 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 4-(aminomethyl)-N-(3-bromo-5-methylphenyl)-1,1-dioxothian-4-amine |
| SMILES | Cc1cc(Br)cc(NC2(CN)CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C13H19BrN2O2S/c1-10-6-11(14)8-12(7-10)16-13(9-15)2-4-19(17,18)5-3-13/h6-8,16H,2-5,9,15H2,1H3 |
| InChIKey | IJWSVTNBFOFNRP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |