C15H17ClN2O4 — CID 10758369
3-(3,4-dihydroxy-2-methylpyridin-1-ium-1-yl)propyl pyridine-2-carboxylate chloride (PubChem CID 10758369) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is 3-(3,4-dihydroxy-2-methylpyridin-1-ium-1-yl)propyl pyridine-2-carboxylate chloride.
| Compound Name | 3-(3,4-dihydroxy-2-methylpyridin-1-ium-1-yl)propyl pyridine-2-carboxylate chloride |
|---|---|
| PubChem CID | 10758369 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-(3,4-dihydroxy-2-methylpyridin-1-ium-1-yl)propyl pyridine-2-carboxylate chloride |
| SMILES | Cc1c(O)c(O)cc[n+]1CCCOC(=O)c1ccccn1.[Cl-] |
| InChI | InChI=1S/C15H16N2O4.ClH/c1-11-14(19)13(18)6-9-17(11)8-4-10-21-15(20)12-5-2-3-7-16-12;/h2-3,5-7,9,19H,4,8,10H2,1H3;1H |
| InChIKey | FAGAQIWSYQNFAB-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|