C18H22NO5+ — CID 10595157
3-(3,4-dihydroxy-2-methylpyridin-1-ium-1-yl)propyl 4-ethoxybenzoate (PubChem CID 10595157) has the molecular formula C18H22NO5+ and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-(3,4-dihydroxy-2-methylpyridin-1-ium-1-yl)propyl 4-ethoxybenzoate.
| Compound Name | 3-(3,4-dihydroxy-2-methylpyridin-1-ium-1-yl)propyl 4-ethoxybenzoate |
|---|---|
| PubChem CID | 10595157 |
| Molecular Formula | C18H22NO5+ |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-(3,4-dihydroxy-2-methylpyridin-1-ium-1-yl)propyl 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCCC[n+]2ccc(O)c(O)c2C)cc1 |
| InChI | InChI=1S/C18H21NO5/c1-3-23-15-7-5-14(6-8-15)18(22)24-12-4-10-19-11-9-16(20)17(21)13(19)2/h5-9,11,21H,3-4,10,12H2,1-2H3/p+1 |
| InChIKey | FCYYDPXVESLPHQ-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|