C11H8F3N5S — CID 107588820
2-(pyrimidin-5-ylamino)-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 107588820) has the molecular formula C11H8F3N5S and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-(pyrimidin-5-ylamino)-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-(pyrimidin-5-ylamino)-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107588820 |
| Molecular Formula | C11H8F3N5S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-(pyrimidin-5-ylamino)-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(C(F)(F)F)nc1Nc1cncnc1 |
| InChI | InChI=1S/C11H8F3N5S/c12-11(13,14)8-2-1-7(9(15)20)10(19-8)18-6-3-16-5-17-4-6/h1-5H,(H2,15,20)(H,18,19) |
| InChIKey | JNEIHUQNNOYPTE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|