C11H10F3N5S — CID 79877653
2-[(1-methylpyrazol-3-yl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 79877653) has the molecular formula C11H10F3N5S and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-3-yl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-[(1-methylpyrazol-3-yl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79877653 |
| Molecular Formula | C11H10F3N5S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[(1-methylpyrazol-3-yl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | Cn1ccc(Nc2nc(C(F)(F)F)ccc2C(N)=S)n1 |
| InChI | InChI=1S/C11H10F3N5S/c1-19-5-4-8(18-19)17-10-6(9(15)20)2-3-7(16-10)11(12,13)14/h2-5H,1H3,(H2,15,20)(H,16,17,18) |
| InChIKey | JLLXGIXAVGISLS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|