C14H7Br2F3N2 — CID 107600328
5-(2,6-dibromoanilino)-2-(trifluoromethyl)benzonitrile (PubChem CID 107600328) has the molecular formula C14H7Br2F3N2 and a molecular weight of 420.03 g/mol. Its IUPAC name is 5-(2,6-dibromoanilino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-(2,6-dibromoanilino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 107600328 |
| Molecular Formula | C14H7Br2F3N2 |
| Molecular Weight | 420.03 g/mol |
| Exact Mass | 417.89 |
| IUPAC Name | 5-(2,6-dibromoanilino)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(Nc2c(Br)cccc2Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H7Br2F3N2/c15-11-2-1-3-12(16)13(11)21-9-4-5-10(14(17,18)19)8(6-9)7-20/h1-6,21H |
| InChIKey | MBBRXNPKZZLRBP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.03 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |