C9H7Br2N3O — CID 107604959
[4-(2,6-dibromophenyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 107604959) has the molecular formula C9H7Br2N3O and a molecular weight of 332.98 g/mol. Its IUPAC name is [4-(2,6-dibromophenyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [4-(2,6-dibromophenyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 107604959 |
| Molecular Formula | C9H7Br2N3O |
| Molecular Weight | 332.98 g/mol |
| Exact Mass | 330.90 |
| IUPAC Name | [4-(2,6-dibromophenyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1nncn1-c1c(Br)cccc1Br |
| InChI | InChI=1S/C9H7Br2N3O/c10-6-2-1-3-7(11)9(6)14-5-12-13-8(14)4-15/h1-3,5,15H,4H2 |
| InChIKey | PUTPWFTVKODOAD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.98 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |