C22H26O5 — CID 10761681
tert-butyl 2-[4-[(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenoxy]acetate (PubChem CID 10761681) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl 2-[4-[(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 10761681 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | tert-butyl 2-[4-[(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenoxy]acetate |
| SMILES | CC1=C(C)C(=O)C(Cc2ccc(OCC(=O)OC(C)(C)C)cc2)=C(C)C1=O |
| InChI | InChI=1S/C22H26O5/c1-13-14(2)21(25)18(15(3)20(13)24)11-16-7-9-17(10-8-16)26-12-19(23)27-22(4,5)6/h7-10H,11-12H2,1-6H3 |
| InChIKey | KYIOKCYQWLDJDZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|