C22H20N2O4 — CID 10762058
methyl (1R,8S,10S,12R)-9-benzoyl-8-cyano-10-methoxy-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carboxylate (PubChem CID 10762058) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl (1R,8S,10S,12R)-9-benzoyl-8-cyano-10-methoxy-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carboxylate.
| Compound Name | methyl (1R,8S,10S,12R)-9-benzoyl-8-cyano-10-methoxy-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carboxylate |
|---|---|
| PubChem CID | 10762058 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl (1R,8S,10S,12R)-9-benzoyl-8-cyano-10-methoxy-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2c3ccccc3[C@@]1(C#N)N(C(=O)c1ccccc1)[C@H]2OC |
| InChI | InChI=1S/C22H20N2O4/c1-27-20-16-12-18(21(26)28-2)22(13-23,17-11-7-6-10-15(16)17)24(20)19(25)14-8-4-3-5-9-14/h3-11,16,18,20H,12H2,1-2H3/t16-,18+,20+,22-/m1/s1 |
| InChIKey | CPEFSGFGDCAZLS-DCZASFAJSA-N |
| XLogP | 2.81 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |