C23H28O3S — CID 10762612
1-[(R)-[(3Z)-8-[(4-methoxyphenyl)methoxy]octa-1,3-dien-3-yl]sulfinyl]-4-methylbenzene (PubChem CID 10762612) has the molecular formula C23H28O3S and a molecular weight of 384.54 g/mol. Its IUPAC name is 1-[(R)-[(3Z)-8-[(4-methoxyphenyl)methoxy]octa-1,3-dien-3-yl]sulfinyl]-4-methylbenzene.
| Compound Name | 1-[(R)-[(3Z)-8-[(4-methoxyphenyl)methoxy]octa-1,3-dien-3-yl]sulfinyl]-4-methylbenzene |
|---|---|
| PubChem CID | 10762612 |
| Molecular Formula | C23H28O3S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[(R)-[(3Z)-8-[(4-methoxyphenyl)methoxy]octa-1,3-dien-3-yl]sulfinyl]-4-methylbenzene |
| SMILES | C=C/C(=C/CCCCOCc1ccc(OC)cc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H28O3S/c1-4-22(27(24)23-15-9-19(2)10-16-23)8-6-5-7-17-26-18-20-11-13-21(25-3)14-12-20/h4,8-16H,1,5-7,17-18H2,2-3H3/b22-8-/t27-/m1/s1 |
| InChIKey | YMXUTKGAWCQLHM-WFIGCRFGSA-N |
| XLogP | 5.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|