C21H19FN4S2 — CID 10764062
6-fluoro-7-(4-methylpiperazin-1-yl)-2,3-dithiophen-2-ylquinoxaline (PubChem CID 10764062) has the molecular formula C21H19FN4S2 and a molecular weight of 410.54 g/mol. Its IUPAC name is 6-fluoro-7-(4-methylpiperazin-1-yl)-2,3-dithiophen-2-ylquinoxaline.
| Compound Name | 6-fluoro-7-(4-methylpiperazin-1-yl)-2,3-dithiophen-2-ylquinoxaline |
|---|---|
| PubChem CID | 10764062 |
| Molecular Formula | C21H19FN4S2 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 6-fluoro-7-(4-methylpiperazin-1-yl)-2,3-dithiophen-2-ylquinoxaline |
| SMILES | CN1CCN(c2cc3nc(-c4cccs4)c(-c4cccs4)nc3cc2F)CC1 |
| InChI | InChI=1S/C21H19FN4S2/c1-25-6-8-26(9-7-25)17-13-16-15(12-14(17)22)23-20(18-4-2-10-27-18)21(24-16)19-5-3-11-28-19/h2-5,10-13H,6-9H2,1H3 |
| InChIKey | BLOUFOUCYURJMS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |