C25H28N2O4 — CID 10764613
2-[4-[(2-butyl-1,4-dioxo-2,3-diazaspiro[4.4]nonan-3-yl)methyl]phenyl]benzoic acid (PubChem CID 10764613) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[4-[(2-butyl-1,4-dioxo-2,3-diazaspiro[4.4]nonan-3-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(2-butyl-1,4-dioxo-2,3-diazaspiro[4.4]nonan-3-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 10764613 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[4-[(2-butyl-1,4-dioxo-2,3-diazaspiro[4.4]nonan-3-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCN1C(=O)C2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-2-3-16-26-23(30)25(14-6-7-15-25)24(31)27(26)17-18-10-12-19(13-11-18)20-8-4-5-9-21(20)22(28)29/h4-5,8-13H,2-3,6-7,14-17H2,1H3,(H,28,29) |
| InChIKey | NUGZKSKUYOJVKT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|