C12H10F4N2O2 — CID 107646468
3,3-dimethyl-1-(2,3,5,6-tetrafluorophenyl)piperazine-2,5-dione (PubChem CID 107646468) has the molecular formula C12H10F4N2O2 and a molecular weight of 290.22 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2,3,5,6-tetrafluorophenyl)piperazine-2,5-dione.
| Compound Name | 3,3-dimethyl-1-(2,3,5,6-tetrafluorophenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 107646468 |
| Molecular Formula | C12H10F4N2O2 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3,3-dimethyl-1-(2,3,5,6-tetrafluorophenyl)piperazine-2,5-dione |
| SMILES | CC1(C)NC(=O)CN(c2c(F)c(F)cc(F)c2F)C1=O |
| InChI | InChI=1S/C12H10F4N2O2/c1-12(2)11(20)18(4-7(19)17-12)10-8(15)5(13)3-6(14)9(10)16/h3H,4H2,1-2H3,(H,17,19) |
| InChIKey | OCDHXYCHKQYBFK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|