C13H12F4N2O2 — CID 107646480
3,3,6-trimethyl-1-(2,3,5,6-tetrafluorophenyl)piperazine-2,5-dione (PubChem CID 107646480) has the molecular formula C13H12F4N2O2 and a molecular weight of 304.24 g/mol. Its IUPAC name is 3,3,6-trimethyl-1-(2,3,5,6-tetrafluorophenyl)piperazine-2,5-dione.
| Compound Name | 3,3,6-trimethyl-1-(2,3,5,6-tetrafluorophenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 107646480 |
| Molecular Formula | C13H12F4N2O2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3,3,6-trimethyl-1-(2,3,5,6-tetrafluorophenyl)piperazine-2,5-dione |
| SMILES | CC1C(=O)NC(C)(C)C(=O)N1c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H12F4N2O2/c1-5-11(20)18-13(2,3)12(21)19(5)10-8(16)6(14)4-7(15)9(10)17/h4-5H,1-3H3,(H,18,20) |
| InChIKey | XGMGHRXZLQTSQG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|