C28H22O4 — CID 10764698
2-[(E)-7-(methoxymethoxy)-7,7-diphenylhept-3-en-1,5-diyn-4-yl]benzoic acid (PubChem CID 10764698) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[(E)-7-(methoxymethoxy)-7,7-diphenylhept-3-en-1,5-diyn-4-yl]benzoic acid.
| Compound Name | 2-[(E)-7-(methoxymethoxy)-7,7-diphenylhept-3-en-1,5-diyn-4-yl]benzoic acid |
|---|---|
| PubChem CID | 10764698 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[(E)-7-(methoxymethoxy)-7,7-diphenylhept-3-en-1,5-diyn-4-yl]benzoic acid |
| SMILES | C#C/C=C(\C#CC(OCOC)(c1ccccc1)c1ccccc1)c1ccccc1C(=O)O |
| InChI | InChI=1S/C28H22O4/c1-3-12-22(25-17-10-11-18-26(25)27(29)30)19-20-28(32-21-31-2,23-13-6-4-7-14-23)24-15-8-5-9-16-24/h1,4-18H,21H2,2H3,(H,29,30)/b22-12+ |
| InChIKey | IGOYRHOSJSSDMW-WSDLNYQXSA-N |
| XLogP | 4.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|