C14H30N2O4Si — CID 10765183
(2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-trimethylsilylpentanoyl]amino]-4-methylpentanoic acid (PubChem CID 10765183) has the molecular formula C14H30N2O4Si and a molecular weight of 318.49 g/mol. Its IUPAC name is (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-trimethylsilylpentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-trimethylsilylpentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 10765183 |
| Molecular Formula | C14H30N2O4Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-trimethylsilylpentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](O)[C@H](N)CC[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H30N2O4Si/c1-9(2)8-11(14(19)20)16-13(18)12(17)10(15)6-7-21(3,4)5/h9-12,17H,6-8,15H2,1-5H3,(H,16,18)(H,19,20)/t10-,11+,12+/m1/s1 |
| InChIKey | FODQBMQWROYUJG-WOPDTQHZSA-N |
| XLogP | 1.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|