C11H13N5O — CID 107653962
1-benzyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)urea (PubChem CID 107653962) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 1-benzyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)urea.
| Compound Name | 1-benzyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)urea |
|---|---|
| PubChem CID | 107653962 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-benzyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)urea |
| SMILES | Cc1nc(NC(=O)NCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C11H13N5O/c1-8-13-10(16-15-8)14-11(17)12-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H3,12,13,14,15,16,17) |
| InChIKey | ZCSXJKSTJFPTIY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |