C13H18N4O2 — CID 107654160
1-N-benzylpiperazine-1,2-dicarboxamide (PubChem CID 107654160) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-N-benzylpiperazine-1,2-dicarboxamide.
| Compound Name | 1-N-benzylpiperazine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 107654160 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-N-benzylpiperazine-1,2-dicarboxamide |
| SMILES | NC(=O)C1CNCCN1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H18N4O2/c14-12(18)11-9-15-6-7-17(11)13(19)16-8-10-4-2-1-3-5-10/h1-5,11,15H,6-9H2,(H2,14,18)(H,16,19) |
| InChIKey | OMNQOUSFLGBFKS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |