C19H21Cl2N3O3 — CID 134584435
4-[[[2-(3-chlorophenyl)piperazine-1-carbonyl]amino]methyl]benzoic acid;hydrochloride (PubChem CID 134584435) has the molecular formula C19H21Cl2N3O3 and a molecular weight of 410.30 g/mol. Its IUPAC name is 4-[[[2-(3-chlorophenyl)piperazine-1-carbonyl]amino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[[2-(3-chlorophenyl)piperazine-1-carbonyl]amino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 134584435 |
| Molecular Formula | C19H21Cl2N3O3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 4-[[[2-(3-chlorophenyl)piperazine-1-carbonyl]amino]methyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CNC(=O)N2CCNCC2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H20ClN3O3.ClH/c20-16-3-1-2-15(10-16)17-12-21-8-9-23(17)19(26)22-11-13-4-6-14(7-5-13)18(24)25;/h1-7,10,17,21H,8-9,11-12H2,(H,22,26)(H,24,25);1H |
| InChIKey | ORCGBBMXHITARH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |