C14H19Cl2N3O — CID 107654303
1-(3,5-dichlorophenyl)-3-[(3-methylpiperidin-3-yl)methyl]urea (PubChem CID 107654303) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[(3-methylpiperidin-3-yl)methyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[(3-methylpiperidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 107654303 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[(3-methylpiperidin-3-yl)methyl]urea |
| SMILES | CC1(CNC(=O)Nc2cc(Cl)cc(Cl)c2)CCCNC1 |
| InChI | InChI=1S/C14H19Cl2N3O/c1-14(3-2-4-17-8-14)9-18-13(20)19-12-6-10(15)5-11(16)7-12/h5-7,17H,2-4,8-9H2,1H3,(H2,18,19,20) |
| InChIKey | DUPHIZNGBNZHTQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |