C24H42O3Sn — CID 10767604
tributyl-[(Z)-[(1S,2R,6R,8S,9R)-8-methyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-3-ylidene]methyl]stannane (PubChem CID 10767604) has the molecular formula C24H42O3Sn and a molecular weight of 497.31 g/mol. Its IUPAC name is tributyl-[(Z)-[(1S,2R,6R,8S,9R)-8-methyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-3-ylidene]methyl]stannane.
| Compound Name | tributyl-[(Z)-[(1S,2R,6R,8S,9R)-8-methyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-3-ylidene]methyl]stannane |
|---|---|
| PubChem CID | 10767604 |
| Molecular Formula | C24H42O3Sn |
| Molecular Weight | 497.31 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | tributyl-[(Z)-[(1S,2R,6R,8S,9R)-8-methyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-3-ylidene]methyl]stannane |
| SMILES | C=C1CO[C@@H]2[C@H]1[C@@H]1/C(=C/[Sn](CCCC)(CCCC)CCCC)CO[C@@H]1O[C@H]2C |
| InChI | InChI=1S/C12H15O3.3C4H9.Sn/c1-6-4-13-11-8(3)15-12-10(9(6)11)7(2)5-14-12;3*1-3-4-2;/h2,8-12H,1,4-5H2,3H3;3*1,3-4H2,2H3;/t8-,9+,10-,11-,12+;;;;/m0..../s1 |
| InChIKey | PEXMVUJEJKTDPH-MOKYGPORSA-N |
| XLogP | 6.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.31 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|