C30H38O5Si — CID 10767902
(4-methoxyphenyl)methyl (5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyhexanoate (PubChem CID 10767902) has the molecular formula C30H38O5Si and a molecular weight of 506.72 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyhexanoate.
| Compound Name | (4-methoxyphenyl)methyl (5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyhexanoate |
|---|---|
| PubChem CID | 10767902 |
| Molecular Formula | C30H38O5Si |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | (4-methoxyphenyl)methyl (5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyhexanoate |
| SMILES | COc1ccc(COC(=O)CCC[C@@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H38O5Si/c1-30(2,3)36(27-13-7-5-8-14-27,28-15-9-6-10-16-28)35-23-25(31)12-11-17-29(32)34-22-24-18-20-26(33-4)21-19-24/h5-10,13-16,18-21,25,31H,11-12,17,22-23H2,1-4H3/t25-/m1/s1 |
| InChIKey | ZVYXHHKRAHRLGN-RUZDIDTESA-N |
| XLogP | 4.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|