C16H18Cl2N2O — CID 107679467
2,6-dichloro-4-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]phenol (PubChem CID 107679467) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is 2,6-dichloro-4-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]phenol.
| Compound Name | 2,6-dichloro-4-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]phenol |
|---|---|
| PubChem CID | 107679467 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2,6-dichloro-4-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]phenol |
| SMILES | Cc1cc(C)c(C(C)Nc2cc(Cl)c(O)c(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C16H18Cl2N2O/c1-8-5-9(2)19-10(3)15(8)11(4)20-12-6-13(17)16(21)14(18)7-12/h5-7,11,20-21H,1-4H3 |
| InChIKey | RUWDVGSZDOIPNZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|