C16H20N2O — CID 43771050
3-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]phenol (PubChem CID 43771050) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]phenol.
| Compound Name | 3-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]phenol |
|---|---|
| PubChem CID | 43771050 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]phenol |
| SMILES | Cc1cc(C)c(C(C)Nc2cccc(O)c2)c(C)n1 |
| InChI | InChI=1S/C16H20N2O/c1-10-8-11(2)17-12(3)16(10)13(4)18-14-6-5-7-15(19)9-14/h5-9,13,18-19H,1-4H3 |
| InChIKey | DLADVHIUYXJNLJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |