C10H15NO — CID 63365086
(1R)-1-(2,4,6-trimethyl-3-pyridinyl)ethanol (PubChem CID 63365086) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (1R)-1-(2,4,6-trimethyl-3-pyridinyl)ethanol.
| Compound Name | (1R)-1-(2,4,6-trimethyl-3-pyridinyl)ethanol |
|---|---|
| PubChem CID | 63365086 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (1R)-1-(2,4,6-trimethyl-3-pyridinyl)ethanol |
| SMILES | Cc1cc(C)c([C@@H](C)O)c(C)n1 |
| InChI | InChI=1S/C10H15NO/c1-6-5-7(2)11-8(3)10(6)9(4)12/h5,9,12H,1-4H3/t9-/m1/s1 |
| InChIKey | JMDOBOOXBSVQLV-SECBINFHSA-N |
| XLogP | 2.06 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |