C16H18F2N2 — CID 43765047
3,5-difluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline (PubChem CID 43765047) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3,5-difluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline.
| Compound Name | 3,5-difluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline |
|---|---|
| PubChem CID | 43765047 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3,5-difluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline |
| SMILES | Cc1cc(C)c(C(C)Nc2cc(F)cc(F)c2)c(C)n1 |
| InChI | InChI=1S/C16H18F2N2/c1-9-5-10(2)19-11(3)16(9)12(4)20-15-7-13(17)6-14(18)8-15/h5-8,12,20H,1-4H3 |
| InChIKey | ZARAYFOVBGVNJQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |