C29H54O5Si — CID 10768034
methyl 7-[(1R,2R,5S)-2-[(E)-3-acetyloxyoct-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxycyclopentyl]heptanoate (PubChem CID 10768034) has the molecular formula C29H54O5Si and a molecular weight of 510.83 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-2-[(E)-3-acetyloxyoct-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,5S)-2-[(E)-3-acetyloxyoct-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 10768034 |
| Molecular Formula | C29H54O5Si |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-2-[(E)-3-acetyloxyoct-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxycyclopentyl]heptanoate |
| SMILES | CCCCCC(/C=C/[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCCCCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C29H54O5Si/c1-9-10-13-16-25(33-23(2)30)21-19-24-20-22-27(34-35(7,8)29(3,4)5)26(24)17-14-11-12-15-18-28(31)32-6/h19,21,24-27H,9-18,20,22H2,1-8H3/b21-19+/t24-,25?,26+,27-/m0/s1 |
| InChIKey | CLRCCJQSGOREMS-RZMFWNNJSA-N |
| XLogP | 7.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|