C15H20FNO5 — CID 107698235
2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(5-fluoro-2-hydroxyphenyl)acetic acid (PubChem CID 107698235) has the molecular formula C15H20FNO5 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(5-fluoro-2-hydroxyphenyl)acetic acid.
| Compound Name | 2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(5-fluoro-2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 107698235 |
| Molecular Formula | C15H20FNO5 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(5-fluoro-2-hydroxyphenyl)acetic acid |
| SMILES | CCN(C(=O)OC(C)(C)C)C(C(=O)O)c1cc(F)ccc1O |
| InChI | InChI=1S/C15H20FNO5/c1-5-17(14(21)22-15(2,3)4)12(13(19)20)10-8-9(16)6-7-11(10)18/h6-8,12,18H,5H2,1-4H3,(H,19,20) |
| InChIKey | YPICOAOOBWNCMT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|