C16H23F2NO2 — CID 145296649
tert-butyl N-[2-(2,4-difluorophenyl)butyl]-N-methylcarbamate (PubChem CID 145296649) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is tert-butyl N-[2-(2,4-difluorophenyl)butyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(2,4-difluorophenyl)butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 145296649 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | tert-butyl N-[2-(2,4-difluorophenyl)butyl]-N-methylcarbamate |
| SMILES | CCC(CN(C)C(=O)OC(C)(C)C)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2NO2/c1-6-11(13-8-7-12(17)9-14(13)18)10-19(5)15(20)21-16(2,3)4/h7-9,11H,6,10H2,1-5H3 |
| InChIKey | VLTKWQAPUXPDCF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |