C39H43NO3Si — CID 10769908
(2S,3S,6S,7aR)-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-phenyl-6-prop-2-enyl-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 10769908) has the molecular formula C39H43NO3Si and a molecular weight of 601.86 g/mol. Its IUPAC name is (2S,3S,6S,7aR)-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-phenyl-6-prop-2-enyl-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (2S,3S,6S,7aR)-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-phenyl-6-prop-2-enyl-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10769908 |
| Molecular Formula | C39H43NO3Si |
| Molecular Weight | 601.86 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | (2S,3S,6S,7aR)-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-phenyl-6-prop-2-enyl-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | C=CC[C@]1(Cc2ccccc2)C[C@H]2O[C@@H](c3ccccc3)[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)N2C1=O |
| InChI | InChI=1S/C39H43NO3Si/c1-5-26-39(27-30-18-10-6-11-19-30)28-35-40(37(39)41)34(36(43-35)31-20-12-7-13-21-31)29-42-44(38(2,3)4,32-22-14-8-15-23-32)33-24-16-9-17-25-33/h5-25,34-36H,1,26-29H2,2-4H3/t34-,35+,36-,39-/m0/s1 |
| InChIKey | IKPFDKYEHTYDHV-OAWHTHRKSA-N |
| XLogP | 7.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.86 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|