C17H23NO2S — CID 107712111
2-[2-[2-amino-1-(3-methylthiophen-2-yl)butoxy]phenyl]ethanol (PubChem CID 107712111) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-[2-[2-amino-1-(3-methylthiophen-2-yl)butoxy]phenyl]ethanol.
| Compound Name | 2-[2-[2-amino-1-(3-methylthiophen-2-yl)butoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 107712111 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[2-[2-amino-1-(3-methylthiophen-2-yl)butoxy]phenyl]ethanol |
| SMILES | CCC(N)C(Oc1ccccc1CCO)c1sccc1C |
| InChI | InChI=1S/C17H23NO2S/c1-3-14(18)16(17-12(2)9-11-21-17)20-15-7-5-4-6-13(15)8-10-19/h4-7,9,11,14,16,19H,3,8,10,18H2,1-2H3 |
| InChIKey | HIJLVBCDSQSCTL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |