About 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine
2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine (PubChem CID 107723105) has the molecular formula C14H14BrClN2O
and a molecular weight of 341.64 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine.
Molecular Properties
| Compound Name | 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine |
| PubChem CID | 107723105 |
| Molecular Formula | C14H14BrClN2O |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine |
| SMILES | Cc1cc(Oc2nc(C)c(C)nc2Cl)cc(C)c1Br |
| InChI | InChI=1S/C14H14BrClN2O/c1-7-5-11(6-8(2)12(7)15)19-14-13(16)17-9(3)10(4)18-14/h5-6H,1-4H3 |
| InChIKey | JLLMETFWYIQLAJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine?
The IUPAC name of 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine (CID 107723105) is 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine.
What is the SMILES notation for 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine?
The canonical SMILES for 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine is Cc1cc(Oc2nc(C)c(C)nc2Cl)cc(C)c1Br.
What is the InChIKey of 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine?
The InChIKey is JLLMETFWYIQLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrClN2O/c1-7-5-11(6-8(2)12(7)15)19-14-13(16)17-9(3)10(4)18-14/h5-6H,1-4H3.
What are the key properties of 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine?
2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine has a molecular weight of 341.64 g/mol, XLogP of 4.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3,5-dimethylphenoxy)-3-chloro-5,6-dimethylpyrazine is sourced from PubChem (CID 107723105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).