C15H16BrNO2 — CID 107724994
(1S)-1-[6-(4-bromo-3,5-dimethylphenoxy)-3-pyridinyl]ethanol (PubChem CID 107724994) has the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. Its IUPAC name is (1S)-1-[6-(4-bromo-3,5-dimethylphenoxy)-3-pyridinyl]ethanol.
| Compound Name | (1S)-1-[6-(4-bromo-3,5-dimethylphenoxy)-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 107724994 |
| Molecular Formula | C15H16BrNO2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | (1S)-1-[6-(4-bromo-3,5-dimethylphenoxy)-3-pyridinyl]ethanol |
| SMILES | Cc1cc(Oc2ccc([C@H](C)O)cn2)cc(C)c1Br |
| InChI | InChI=1S/C15H16BrNO2/c1-9-6-13(7-10(2)15(9)16)19-14-5-4-12(8-17-14)11(3)18/h4-8,11,18H,1-3H3/t11-/m0/s1 |
| InChIKey | GNSUPWRQTLOHHE-NSHDSACASA-N |
| XLogP | 4.31 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |