C7H12O — CID 10772955
(1S,5R)-3-deuterio-5-methylcyclohex-2-en-1-ol (PubChem CID 10772955) has the molecular formula C7H12O and a molecular weight of 113.18 g/mol. Its IUPAC name is (1S,5R)-3-deuterio-5-methylcyclohex-2-en-1-ol.
| Compound Name | (1S,5R)-3-deuterio-5-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10772955 |
| Molecular Formula | C7H12O |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | (1S,5R)-3-deuterio-5-methylcyclohex-2-en-1-ol |
| SMILES | [2H]C1=C[C@@H](O)C[C@H](C)C1 |
| InChI | InChI=1S/C7H12O/c1-6-3-2-4-7(8)5-6/h2,4,6-8H,3,5H2,1H3/t6-,7-/m1/s1/i2D |
| InChIKey | RABYZONTKHYCAK-JCAYRDFLSA-N |
| XLogP | 1.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|