C10H18O3 — CID 10773904
(3S,5R)-5-[(E)-4-hydroxybut-2-en-2-yl]-2,2-dimethyloxolan-3-ol (PubChem CID 10773904) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3S,5R)-5-[(E)-4-hydroxybut-2-en-2-yl]-2,2-dimethyloxolan-3-ol.
| Compound Name | (3S,5R)-5-[(E)-4-hydroxybut-2-en-2-yl]-2,2-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 10773904 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3S,5R)-5-[(E)-4-hydroxybut-2-en-2-yl]-2,2-dimethyloxolan-3-ol |
| SMILES | C/C(=C\CO)[C@H]1C[C@H](O)C(C)(C)O1 |
| InChI | InChI=1S/C10H18O3/c1-7(4-5-11)8-6-9(12)10(2,3)13-8/h4,8-9,11-12H,5-6H2,1-3H3/b7-4+/t8-,9+/m1/s1 |
| InChIKey | IHHQHUMLWMNJGX-CNTVWIKJSA-N |
| XLogP | 0.85 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|