C13H23NO2S2 — CID 107757631
N-[2-(2-methylbutylsulfonyl)ethyl]-1-thiophen-2-ylethanamine (PubChem CID 107757631) has the molecular formula C13H23NO2S2 and a molecular weight of 289.47 g/mol. Its IUPAC name is N-[2-(2-methylbutylsulfonyl)ethyl]-1-thiophen-2-ylethanamine.
| Compound Name | N-[2-(2-methylbutylsulfonyl)ethyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 107757631 |
| Molecular Formula | C13H23NO2S2 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[2-(2-methylbutylsulfonyl)ethyl]-1-thiophen-2-ylethanamine |
| SMILES | CCC(C)CS(=O)(=O)CCNC(C)c1cccs1 |
| InChI | InChI=1S/C13H23NO2S2/c1-4-11(2)10-18(15,16)9-7-14-12(3)13-6-5-8-17-13/h5-6,8,11-12,14H,4,7,9-10H2,1-3H3 |
| InChIKey | SECRRJBBWHRYFW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |