C15H25NO2S — CID 107758585
1-(2,4-dimethylphenyl)-2-pentylsulfonylethanamine (PubChem CID 107758585) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-pentylsulfonylethanamine.
| Compound Name | 1-(2,4-dimethylphenyl)-2-pentylsulfonylethanamine |
|---|---|
| PubChem CID | 107758585 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-pentylsulfonylethanamine |
| SMILES | CCCCCS(=O)(=O)CC(N)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H25NO2S/c1-4-5-6-9-19(17,18)11-15(16)14-8-7-12(2)10-13(14)3/h7-8,10,15H,4-6,9,11,16H2,1-3H3 |
| InChIKey | FESKBPBXPWVLMI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|