C8H10BrNO2S2 — CID 107773669
(2S)-2-amino-3-[(5-bromothiophen-3-yl)methylsulfanyl]propanoic acid (PubChem CID 107773669) has the molecular formula C8H10BrNO2S2 and a molecular weight of 296.21 g/mol. Its IUPAC name is (2S)-2-amino-3-[(5-bromothiophen-3-yl)methylsulfanyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[(5-bromothiophen-3-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107773669 |
| Molecular Formula | C8H10BrNO2S2 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | (2S)-2-amino-3-[(5-bromothiophen-3-yl)methylsulfanyl]propanoic acid |
| SMILES | N[C@H](CSCc1csc(Br)c1)C(=O)O |
| InChI | InChI=1S/C8H10BrNO2S2/c9-7-1-5(3-14-7)2-13-4-6(10)8(11)12/h1,3,6H,2,4,10H2,(H,11,12)/t6-/m1/s1 |
| InChIKey | HDAHQRPGDLOECW-ZCFIWIBFSA-N |
| XLogP | 2.16 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |