C14H13BrO2S2 — CID 60793189
2-[(5-bromothiophen-3-yl)methylsulfanyl]-3-phenylpropanoic acid (PubChem CID 60793189) has the molecular formula C14H13BrO2S2 and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-[(5-bromothiophen-3-yl)methylsulfanyl]-3-phenylpropanoic acid.
| Compound Name | 2-[(5-bromothiophen-3-yl)methylsulfanyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 60793189 |
| Molecular Formula | C14H13BrO2S2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | 2-[(5-bromothiophen-3-yl)methylsulfanyl]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)SCc1csc(Br)c1 |
| InChI | InChI=1S/C14H13BrO2S2/c15-13-7-11(9-19-13)8-18-12(14(16)17)6-10-4-2-1-3-5-10/h1-5,7,9,12H,6,8H2,(H,16,17) |
| InChIKey | CYXKSFYNGCFBDC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |