C16H14BrFO2S — CID 79697830
2-[(3-bromo-5-fluorophenyl)methylsulfanyl]-3-phenylpropanoic acid (PubChem CID 79697830) has the molecular formula C16H14BrFO2S and a molecular weight of 369.26 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenyl)methylsulfanyl]-3-phenylpropanoic acid.
| Compound Name | 2-[(3-bromo-5-fluorophenyl)methylsulfanyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 79697830 |
| Molecular Formula | C16H14BrFO2S |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenyl)methylsulfanyl]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)SCc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C16H14BrFO2S/c17-13-6-12(7-14(18)9-13)10-21-15(16(19)20)8-11-4-2-1-3-5-11/h1-7,9,15H,8,10H2,(H,19,20) |
| InChIKey | UFQABCOYSVRZSZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |