C14H19BrN2O2S — CID 107777569
methyl 2-[1-[(6-bromo-2-propylpyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777569) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is methyl 2-[1-[(6-bromo-2-propylpyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(6-bromo-2-propylpyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777569 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | methyl 2-[1-[(6-bromo-2-propylpyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | CCCc1nc(Br)cc(SCC2(CC(=O)OC)CC2)n1 |
| InChI | InChI=1S/C14H19BrN2O2S/c1-3-4-11-16-10(15)7-12(17-11)20-9-14(5-6-14)8-13(18)19-2/h7H,3-6,8-9H2,1-2H3 |
| InChIKey | MXTOWPVDDNTTBX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |