C8H7ClN4OS — CID 107783386
[4-chloro-6-(1H-imidazol-2-ylsulfanyl)pyrimidin-5-yl]methanol (PubChem CID 107783386) has the molecular formula C8H7ClN4OS and a molecular weight of 242.69 g/mol. Its IUPAC name is [4-chloro-6-(1H-imidazol-2-ylsulfanyl)pyrimidin-5-yl]methanol.
| Compound Name | [4-chloro-6-(1H-imidazol-2-ylsulfanyl)pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 107783386 |
| Molecular Formula | C8H7ClN4OS |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | [4-chloro-6-(1H-imidazol-2-ylsulfanyl)pyrimidin-5-yl]methanol |
| SMILES | OCc1c(Cl)ncnc1Sc1ncc[nH]1 |
| InChI | InChI=1S/C8H7ClN4OS/c9-6-5(3-14)7(13-4-12-6)15-8-10-1-2-11-8/h1-2,4,14H,3H2,(H,10,11) |
| InChIKey | OYUWHKKJJWTCEE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |